Systematic / IUPAC Name: 1-{2-Methyl-3-[4-(2-methyl-2-propanyl)phenyl]propyl}piperidine
ID: Reference1038
Other Names:
Fenpropidine;
Patrol;
1-{3-[4-(1,1-Dimethylethyl)phenyl]-2-methylpropyl}piperidine ;
1-[3-(4-tert-Butylphenyl)-2-methylpropyl]piperidine ;
Piperidine, 1-{3-[4-(1,1-dimethylethyl)phenyl]-2-methylpropyl}-
Formula: C19H31N
Class: Pesticides/Herbicides
Fenpropidin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 693 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/14/2016 11:59:47 AM |
| InChI | InChI=1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3 |
| InChI Key | MGNFYQILYYYUBS-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC=C(C=C1)C(C)(C)C)CN2CCCCC2 |
| CAS | 67306007 |
| Splash | |
| Other Names |
Fenpropidine; Patrol; 1-{3-[4-(1,1-Dimethylethyl)phenyl]-2-methylpropyl}piperidine ; 1-[3-(4-tert-Butylphenyl)-2-methylpropyl]piperidine ; Piperidine, 1-{3-[4-(1,1-dimethylethyl)phenyl]-2-methylpropyl}- |
| ChEMBL | CHEMBL1889041 |
| ChemIDPlus | 067306007 |
| PubChem | 91694 |
| ChemSpider | 82797 |
| KEGG | C18726 |
| Wikipedia | Fenpropidin (DE) |