Systematic / IUPAC Name: N-[4-[[(3S)-3-[5-(2-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methyl]phenyl]acetamide
ID: Reference10381
Other Names:
Acetamide, N-[4-[[(3S)-3-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]methyl]phenyl]-;
NAT31-459609
Formula: C22H24N4O3
N-[4-({(3S)-3-[5-(2-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl}methyl)phenyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2660 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 10:18:32 AM |
| InChI | InChI=1S/C22H24N4O3/c1-15(27)23-18-9-7-16(8-10-18)13-26-12-11-17(14-26)21-24-25-22(29-21)19-5-3-4-6-20(19)28-2/h3-10,17H,11-14H2,1-2H3,(H,23,27)/t17-/m0/s1 |
| InChI Key | MBXNEGRYIVJKEM-KRWDZBQOSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CN2CCC(C2)C3=NN=C(O3)C4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names |
Acetamide, N-[4-[[(3S)-3-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]methyl]phenyl]-; NAT31-459609 |