Systematic / IUPAC Name: 1-Methyl-2-[(3S)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzimidazole
ID: Reference10385
Other Names: NAT31-470411
Formula: C21H25N3
1-Methyl-2-[(3S)-1-(3-phenylpropyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 410 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 8:55:21 AM |
| InChI | InChI=1S/C21H25N3/c1-23-20-12-6-5-11-19(20)22-21(23)18-13-15-24(16-18)14-7-10-17-8-3-2-4-9-17/h2-6,8-9,11-12,18H,7,10,13-16H2,1H3/t18-/m0/s1 |
| InChI Key | YEHHVSPRHHRKMP-SFHVURJKSA-N |
| Canonical SMILES | CN1C2=CC=CC=C2N=C1C3CCN(C3)CCCC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT31-470411 |