Systematic / IUPAC Name: 2-[(3S)-1-[(3-Chlorophenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole-4-carboxamide
ID: Reference10386
Other Names: NAT31-470160
Formula: C19H19ClN4O
2-[(3S)-1-(3-Chlorobenzyl)-3-pyrrolidinyl]-1H-benzimidazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1895 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 8:59:23 AM |
| InChI | InChI=1S/C19H19ClN4O/c20-14-4-1-3-12(9-14)10-24-8-7-13(11-24)19-22-16-6-2-5-15(18(21)25)17(16)23-19/h1-6,9,13H,7-8,10-11H2,(H2,21,25)(H,22,23)/t13-/m0/s1 |
| InChI Key | JKJAMZXPTXROAK-ZDUSSCGKSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(C=CC=C3N2)C(=O)N)CC4=CC(=CC=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT31-470160 |