Systematic / IUPAC Name: 2-[(3S)-1-[(3-Methoxyphenyl)methyl]pyrrolidin-3-yl]-1,3-benzothiazole
ID: Reference10389
Other Names:
Benzothiazole, 2-[(3S)-1-[(3-methoxyphenyl)methyl]-3-pyrrolidinyl]-;
NAT31-456981
Formula: C19H20N2OS
2-[(3S)-1-(3-Methoxybenzyl)-3-pyrrolidinyl]-1,3-benzothiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 865 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2021 9:20:19 AM |
| InChI | InChI=1S/C19H20N2OS/c1-22-16-6-4-5-14(11-16)12-21-10-9-15(13-21)19-20-17-7-2-3-8-18(17)23-19/h2-8,11,15H,9-10,12-13H2,1H3/t15-/m0/s1 |
| InChI Key | JSSJNSQEFWGMKR-HNNXBMFYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)CN2CCC(C2)C3=NC4=CC=CC=C4S3 |
| CAS | |
| Splash | |
| Other Names |
Benzothiazole, 2-[(3S)-1-[(3-methoxyphenyl)methyl]-3-pyrrolidinyl]-; NAT31-456981 |