Systematic / IUPAC Name: N-[[(1S,4S,6S)-3-Methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide
ID: Reference10391
Other Names:
Benzamide, N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-;
NAT28-405054
Formula: C25H37N3O2
N-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl}methyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1403 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 10:52:24 AM |
| InChI | InChI=1S/C25H37N3O2/c1-18(2)23-15-21(16-24(29)28-12-10-27(4)11-13-28)19(3)14-22(23)17-26-25(30)20-8-6-5-7-9-20/h5-9,14,18,21-23H,10-13,15-17H2,1-4H3,(H,26,30)/t21-,22-,23-/m0/s1 |
| InChI Key | SAYALHQMYTYGMY-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCN(CC2)C)C(C)C)CNC(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-; NAT28-405054 |