Systematic / IUPAC Name: N-Methyl-2-[(1S,4S,5S)-2-methyl-5-propan-2-yl-4-[(propan-2-ylcarbamoylamino)methyl]cyclohex-2-en-1-yl]-N-(pyridin-3-ylmethyl)acetamide
ID: Reference10395
Other Names: NAT28-408086
Formula: C24H38N4O2
2-[(1S,4S,5S)-5-Isopropyl-4-{[(isopropylcarbamoyl)amino]methyl}-2-methyl-2-cyclohexen-1-yl]-N-methyl-N-(3-pyridinylmethyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2452 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 11:06:07 AM |
| InChI | InChI=1S/C24H38N4O2/c1-16(2)22-11-20(12-23(29)28(6)15-19-8-7-9-25-13-19)18(5)10-21(22)14-26-24(30)27-17(3)4/h7-10,13,16-17,20-22H,11-12,14-15H2,1-6H3,(H2,26,27,30)/t20-,21-,22-/m0/s1 |
| InChI Key | VPNQOHLYUFTHNM-FKBYEOEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CN=CC=C2)C(C)C)CNC(=O)NC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-408086 |