Systematic / IUPAC Name: N,N-Dimethyl-4-[5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]pyrrolidin-3-yl]-1,3,4-oxadiazol-2-yl]aniline
ID: Reference10397
Other Names:
Benzenamine, N,N-dimethyl-4-[5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]-;
NAT31-460146
Formula: C22H23F3N4O2
N,N-Dimethyl-4-(5-{(3S)-1-[3-(trifluoromethoxy)benzyl]-3-pyrrolidinyl}-1,3,4-oxadiazol-2-yl)aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2314 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 11:11:21 AM |
| InChI | InChI=1S/C22H23F3N4O2/c1-28(2)18-8-6-16(7-9-18)20-26-27-21(30-20)17-10-11-29(14-17)13-15-4-3-5-19(12-15)31-22(23,24)25/h3-9,12,17H,10-11,13-14H2,1-2H3/t17-/m0/s1 |
| InChI Key | DYYSSPQPTDLRQW-KRWDZBQOSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C2=NN=C(O2)C3CCN(C3)CC4=CC(=CC=C4)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Benzenamine, N,N-dimethyl-4-[5-[(3S)-1-[[3-(trifluoromethoxy)phenyl]methyl]-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]-; NAT31-460146 |