Systematic / IUPAC Name: 1-[4-[(3S)-3-[5-[4-(Dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10398
Other Names:
Ethanone, 1-[4-[(3S)-3-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]-1-piperidinyl]-;
NAT31-460148
Formula: C21H29N5O2
1-{4-[(3S)-3-{5-[4-(Dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl}-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2915 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 11:13:42 AM |
| InChI | InChI=1S/C21H29N5O2/c1-15(27)25-12-9-19(10-13-25)26-11-8-17(14-26)21-23-22-20(28-21)16-4-6-18(7-5-16)24(2)3/h4-7,17,19H,8-14H2,1-3H3/t17-/m0/s1 |
| InChI Key | IVSNRUJOSDTLNO-KRWDZBQOSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCC(C2)C3=NN=C(O3)C4=CC=C(C=C4)N(C)C |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 1-[4-[(3S)-3-[5-[4-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]-1-piperidinyl]-; NAT31-460148 |