Systematic / IUPAC Name: N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide
ID: Reference1040
Other Names:
3-Pyridinecarboxamide, N-(cyanomethyl)-4-(trifluoromethyl)-;
N-(Cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide
Formula: C9H6F3N3O
Class: Pesticides/Herbicides
Flonicamid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 109 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 12:32:59 PM |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChI Key | RLQJEEJISHYWON-UHFFFAOYSA-N |
| Canonical SMILES | C1=CN=CC(=C1C(F)(F)F)C(=O)NCC#N |
| CAS | 120067836 |
| Splash | |
| Other Names |
3-Pyridinecarboxamide, N-(cyanomethyl)-4-(trifluoromethyl)-; N-(Cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| ChEBI | CHEBI:39291 |
| ChemSpider | 8010234 |
| KEGG | C18463 |
| PubChem | 9834513 |
| Wikipedia | Flonicamid (DE) |
| ChEMBL | CHEMBL1882892 |