Systematic / IUPAC Name: N-[2-(Dimethylamino)ethyl]-2-[(1S,4S,5S)-2-methyl-4-[(phenylcarbamoylamino)methyl]-5-propan-2-ylcyclohex-2-en-1-yl]acetamide
ID: Reference10403
Other Names: NAT28-403670
Formula: C24H38N4O2
N-[2-(Dimethylamino)ethyl]-2-[(1S,4S,5S)-5-isopropyl-2-methyl-4-{[(phenylcarbamoyl)amino]methyl}-2-cyclohexen-1-yl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 907 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 11:35:56 AM |
| InChI | InChI=1S/C24H38N4O2/c1-17(2)22-14-19(15-23(29)25-11-12-28(4)5)18(3)13-20(22)16-26-24(30)27-21-9-7-6-8-10-21/h6-10,13,17,19-20,22H,11-12,14-16H2,1-5H3,(H,25,29)(H2,26,27,30)/t19-,20-,22-/m0/s1 |
| InChI Key | GJIRBPZTNGYZIV-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCCN(C)C)C(C)C)CNC(=O)NC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | NAT28-403670 |