Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-[[(3-Methoxyphenyl)carbamoylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-methyl-N-(pyridin-3-ylmethyl)acetamide
ID: Reference10407
Other Names: NAT28-408087
Formula: C28H38N4O3
2-[(1S,4S,5S)-5-Isopropyl-4-({[(3-methoxyphenyl)carbamoyl]amino}methyl)-2-methyl-2-cyclohexen-1-yl]-N-methyl-N-(3-pyridinylmethyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1725 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 10:42:31 AM |
| InChI | InChI=1S/C28H38N4O3/c1-19(2)26-13-22(14-27(33)32(4)18-21-8-7-11-29-16-21)20(3)12-23(26)17-30-28(34)31-24-9-6-10-25(15-24)35-5/h6-12,15-16,19,22-23,26H,13-14,17-18H2,1-5H3,(H2,30,31,34)/t22-,23-,26-/m0/s1 |
| InChI Key | OLUZVMNGCZPJMT-FXSPECFOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CN=CC=C2)C(C)C)CNC(=O)NC3=CC(=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT28-408087 |