Systematic / IUPAC Name: 2-(4-fluoro-N-propan-2-ylanilino)-2-oxoacetic acid
ID: Reference1042
Other Names:
Flufenacet oxalate;
N-(4-Fluorophenyl)-N-(1-methylethyl)oxalamic acid;
Flufenacet OA
Formula: C11H12FNO3
Class: Pesticides/Herbicides
Flufenacet OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 121 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 12:43:39 PM |
| InChI | InChI=1S/C11H12FNO3/c1-7(2)13(10(14)11(15)16)9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H,15,16) |
| InChI Key | FFKNXXCOXIZLJD-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N(C1=CC=C(C=C1)F)C(=O)C(=O)O |
| CAS | 201668317 |
| Splash | |
| Other Names |
Flufenacet oxalate; N-(4-Fluorophenyl)-N-(1-methylethyl)oxalamic acid; Flufenacet OA |