Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[Benzyl(methyl)amino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]cyclopropanecarboxamide
ID: Reference10420
Other Names: NAT28-402595
Formula: C25H36N2O2
N-{[(1S,4S,6S)-4-{2-[Benzyl(methyl)amino]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}cyclopropanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 521 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2021 12:21:43 PM |
| InChI | InChI=1S/C25H36N2O2/c1-17(2)23-13-21(14-24(28)27(4)16-19-8-6-5-7-9-19)18(3)12-22(23)15-26-25(29)20-10-11-20/h5-9,12,17,20-23H,10-11,13-16H2,1-4H3,(H,26,29)/t21-,22-,23-/m0/s1 |
| InChI Key | PWOLVDNLKDSJTA-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CC=CC=C2)C(C)C)CNC(=O)C3CC3 |
| CAS | |
| Splash | |
| Other Names | NAT28-402595 |