Systematic / IUPAC Name: 3-Methoxy-N-[[(1S,4S,6S)-3-methyl-4-[2-oxo-2-(pyridin-2-ylmethylamino)ethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]propanamide
ID: Reference10426
Other Names: NAT28-405636
Formula: C23H35N3O3
N-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{2-oxo-2-[(2-pyridinylmethyl)amino]ethyl}-2-cyclohexen-1-yl]methyl}-3-methoxypropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1365 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2021 8:24:05 AM |
| InChI | InChI=1S/C23H35N3O3/c1-16(2)21-12-18(13-23(28)26-15-20-7-5-6-9-24-20)17(3)11-19(21)14-25-22(27)8-10-29-4/h5-7,9,11,16,18-19,21H,8,10,12-15H2,1-4H3,(H,25,27)(H,26,28)/t18-,19-,21-/m0/s1 |
| InChI Key | SXVLPMVGJLXTLD-ZJOUEHCJSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=CC=N2)C(C)C)CNC(=O)CCOC |
| CAS | |
| Splash | |
| Other Names | NAT28-405636 |