Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-[[(3-Methoxyphenyl)carbamoylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(pyridin-2-ylmethyl)acetamide
ID: Reference10427
Other Names: NAT28-405622
Formula: C27H36N4O3
2-[(1S,4S,5S)-5-Isopropyl-4-({[(3-methoxyphenyl)carbamoyl]amino}methyl)-2-methyl-2-cyclohexen-1-yl]-N-(2-pyridinylmethyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 920 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2021 8:24:57 AM |
| InChI | InChI=1S/C27H36N4O3/c1-18(2)25-13-20(14-26(32)29-17-23-8-5-6-11-28-23)19(3)12-21(25)16-30-27(33)31-22-9-7-10-24(15-22)34-4/h5-12,15,18,20-21,25H,13-14,16-17H2,1-4H3,(H,29,32)(H2,30,31,33)/t20-,21-,25-/m0/s1 |
| InChI Key | HKZDKMCNLKVWCR-WATLYSKOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=CC=N2)C(C)C)CNC(=O)NC3=CC(=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT28-405622 |