Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[(4-Cyanophenyl)methylamino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]pyridine-2-carboxamide
ID: Reference10438
Other Names: NAT28-408361
Formula: C27H32N4O2
N-{[(1S,4S,6S)-4-{2-[(4-Cyanobenzyl)amino]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}-2-pyridinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1032 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/6/2021 2:46:24 PM |
| InChI | InChI=1S/C27H32N4O2/c1-18(2)24-13-22(14-26(32)30-16-21-9-7-20(15-28)8-10-21)19(3)12-23(24)17-31-27(33)25-6-4-5-11-29-25/h4-12,18,22-24H,13-14,16-17H2,1-3H3,(H,30,32)(H,31,33)/t22-,23-,24-/m0/s1 |
| InChI Key | ZMXSZUITFSBMGD-HJOGWXRNSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=C(C=C2)C#N)C(C)C)CNC(=O)C3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names | NAT28-408361 |