Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-[[(3-Fluorophenyl)carbamoylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(pyridin-3-ylmethyl)acetamide
ID: Reference10444
Other Names: NAT28-405715
Formula: C26H33FN4O2
2-[(1S,4S,5S)-4-({[(3-Fluorophenyl)carbamoyl]amino}methyl)-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-N-(3-pyridinylmethyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1595 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/6/2021 12:55:07 PM |
| InChI | InChI=1S/C26H33FN4O2/c1-17(2)24-11-20(12-25(32)29-15-19-6-5-9-28-14-19)18(3)10-21(24)16-30-26(33)31-23-8-4-7-22(27)13-23/h4-10,13-14,17,20-21,24H,11-12,15-16H2,1-3H3,(H,29,32)(H2,30,31,33)/t20-,21-,24-/m0/s1 |
| InChI Key | KZEILSJLYHDWOH-HFMPRLQTSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CN=CC=C2)C(C)C)CNC(=O)NC3=CC(=CC=C3)F |
| CAS | |
| Splash | |
| Other Names | NAT28-405715 |