Systematic / IUPAC Name: N-[[(1S,4S,6S)-3-Methyl-4-[2-oxo-2-(pyridin-2-ylamino)ethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]furan-2-carboxamide
ID: Reference10447
Other Names: NAT28-408805
Formula: C23H29N3O3
N-[[(1S,4S,6S)-6-Isopropyl-3-methyl-4-[2-oxo-2-(2-pyridylamino)ethyl]cyclohex-2-en-1-yl]methyl]furan-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1353 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2021 7:14:37 AM |
| InChI | InChI=1S/C23H29N3O3/c1-15(2)19-12-17(13-22(27)26-21-8-4-5-9-24-21)16(3)11-18(19)14-25-23(28)20-7-6-10-29-20/h4-11,15,17-19H,12-14H2,1-3H3,(H,25,28)(H,24,26,27)/t17-,18-,19-/m0/s1 |
| InChI Key | CMDKPQRGARFWCS-FHWLQOOXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2=CC=CC=N2)C(C)C)CNC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | NAT28-408805 |