Systematic / IUPAC Name: 4-Methyl-N-[[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide
ID: Reference10452
Other Names:
Benzamide, 4-methyl-N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-;
NAT28-405332
Formula: C25H36N2O3
N-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl}methyl)-4-methylbenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3567 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2021 7:45:33 AM |
| InChI | InChI=1S/C25H36N2O3/c1-17(2)23-14-21(15-24(28)27-9-11-30-12-10-27)19(4)13-22(23)16-26-25(29)20-7-5-18(3)6-8-20/h5-8,13,17,21-23H,9-12,14-16H2,1-4H3,(H,26,29)/t21-,22-,23-/m0/s1 |
| InChI Key | ZDXLQHKOJGCZOJ-VABKMULXSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)NCC2C=C(C(CC2C(C)C)CC(=O)N3CCOCC3)C |
| CAS | |
| Splash | |
| Other Names |
Benzamide, 4-methyl-N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-; NAT28-405332 |