Systematic / IUPAC Name: (3R,4R,6R)-N-Methyl-N-prop-2-enyl-6-[(4-pyridin-2-yltriazol-1-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide
ID: Reference10462
Other Names: NAT13-309234
Formula: C20H26N6O
(3R,4R,6R)-N-Allyl-N-methyl-6-{[4-(2-pyridinyl)-1H-1,2,3-triazol-1-yl]methyl}quinuclidine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2210 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2021 9:59:05 AM |
| InChI | InChI=1S/C20H26N6O/c1-3-9-24(2)20(27)17-13-25-10-7-15(17)11-16(25)12-26-14-19(22-23-26)18-6-4-5-8-21-18/h3-6,8,14-17H,1,7,9-13H2,2H3/t15-,16-,17+/m1/s1 |
| InChI Key | XRVWHBHPKWYVFH-ZACQAIPSSA-N |
| Canonical SMILES | CN(CC=C)C(=O)C1CN2CCC1CC2CN3C=C(N=N3)C4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT13-309234 |