Systematic / IUPAC Name: (3R,4S)-4-[2-(Cyclopropylamino)-2-oxoethyl]-3-ethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide
ID: Reference10467
Other Names: NAT14-323589
Formula: C20H26F3N3O2
(3R,4S)-4-[2-(Cyclopropylamino)-2-oxoethyl]-3-ethyl-N-[3-(trifluoromethyl)phenyl]-1-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3455 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2021 10:31:37 AM |
| InChI | InChI=1S/C20H26F3N3O2/c1-2-13-12-26(9-8-14(13)10-18(27)24-16-6-7-16)19(28)25-17-5-3-4-15(11-17)20(21,22)23/h3-5,11,13-14,16H,2,6-10,12H2,1H3,(H,24,27)(H,25,28)/t13-,14-/m0/s1 |
| InChI Key | SCHFHUYYXBFSMD-KBPBESRZSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)NC2CC2)C(=O)NC3=CC=CC(=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT14-323589 |