Systematic / IUPAC Name: 1-[(3S)-3-(1,3-Benzoxazol-2-yl)pyrrolidin-1-yl]-3-methoxypropan-1-one
ID: Reference10469
Other Names: NAT31-453986
Formula: C15H18N2O3
1-[(3S)-3-(1,3-Benzoxazol-2-yl)-1-pyrrolidinyl]-3-methoxy-1-propanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1338 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 6:57:37 AM |
| InChI | InChI=1S/C15H18N2O3/c1-19-9-7-14(18)17-8-6-11(10-17)15-16-12-4-2-3-5-13(12)20-15/h2-5,11H,6-10H2,1H3/t11-/m0/s1 |
| InChI Key | NVLJDFSAYBUYQS-NSHDSACASA-N |
| Canonical SMILES | COCCC(=O)N1CCC(C1)C2=NC3=CC=CC=C3O2 |
| CAS | |
| Splash | |
| Other Names | NAT31-453986 |