Systematic / IUPAC Name: Cyclohexyl-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference10472
Other Names: NAT31-454348
Formula: C19H25N3O
Cyclohexyl[(3S)-3-(5-methyl-1H-benzimidazol-2-yl)-1-pyrrolidinyl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 848 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 7:23:41 AM |
| InChI | InChI=1S/C19H25N3O/c1-13-7-8-16-17(11-13)21-18(20-16)15-9-10-22(12-15)19(23)14-5-3-2-4-6-14/h7-8,11,14-15H,2-6,9-10,12H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChI Key | IWPLOZYWPQSRHI-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C(=O)C4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-454348 |