Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]cyclopropanecarboxamide
ID: Reference10475
Other Names: NAT28-403275
Formula: C22H36N2O2
N-({(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-6-isopropyl-3-methyl-2-cyclohexen-1-yl}methyl)cyclopropanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3371 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 12:21:04 PM |
| InChI | InChI=1S/C22H36N2O2/c1-14(2)20-11-17(12-21(25)24-19-6-4-5-7-19)15(3)10-18(20)13-23-22(26)16-8-9-16/h10,14,16-20H,4-9,11-13H2,1-3H3,(H,23,26)(H,24,25)/t17-,18-,20-/m0/s1 |
| InChI Key | MFBMITFJMXZMIP-BJLQDIEVSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2CCCC2)C(C)C)CNC(=O)C3CC3 |
| CAS | |
| Splash | |
| Other Names | NAT28-403275 |