Systematic / IUPAC Name: N-Cyclopentyl-2-[(1S,4S,5S)-2-methyl-4-[[(2-phenoxyacetyl)amino]methyl]-5-propan-2-ylcyclohex-2-en-1-yl]acetamide
ID: Reference10476
Other Names: NAT28-403287
Formula: C26H38N2O3
N-Cyclopentyl-2-[(1S,4S,5S)-5-isopropyl-2-methyl-4-{[(phenoxyacetyl)amino]methyl}-2-cyclohexen-1-yl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4579 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 12:23:21 PM |
| InChI | InChI=1S/C26H38N2O3/c1-18(2)24-14-20(15-25(29)28-22-9-7-8-10-22)19(3)13-21(24)16-27-26(30)17-31-23-11-5-4-6-12-23/h4-6,11-13,18,20-22,24H,7-10,14-17H2,1-3H3,(H,27,30)(H,28,29)/t20-,21-,24-/m0/s1 |
| InChI Key | KWEJWNJPHGOXDS-HFMPRLQTSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2CCCC2)C(C)C)CNC(=O)COC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT28-403287 |