Systematic / IUPAC Name: [(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]-phenylmethanone
ID: Reference10480
Other Names: NAT31-453549
Formula: C18H15ClN2O2
[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)-1-pyrrolidinyl](phenyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 12:35:14 PM |
| InChI | InChI=1S/C18H15ClN2O2/c19-14-6-7-16-15(10-14)20-17(23-16)13-8-9-21(11-13)18(22)12-4-2-1-3-5-12/h1-7,10,13H,8-9,11H2/t13-/m0/s1 |
| InChI Key | UKROVUUNVSKBCJ-ZDUSSCGKSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(O2)C=CC(=C3)Cl)C(=O)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT31-453549 |