Systematic / IUPAC Name: Cyclopropyl-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methanone
ID: Reference10489
Other Names: NAT31-454349
Formula: C16H19N3O
Cyclopropyl[(3S)-3-(5-methyl-1H-benzimidazol-2-yl)-1-pyrrolidinyl]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2120 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 7:18:40 AM |
| InChI | InChI=1S/C16H19N3O/c1-10-2-5-13-14(8-10)18-15(17-13)12-6-7-19(9-12)16(20)11-3-4-11/h2,5,8,11-12H,3-4,6-7,9H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChI Key | ITGGMFBVRHBAOZ-LBPRGKRZSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C(=O)C4CC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-454349 |