Systematic / IUPAC Name: 1-[4-[(3S)-3-(6-Methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10492
Other Names: NAT31-457184
Formula: C19H26N4O
1-{4-[(3S)-3-(5-Methyl-1H-benzimidazol-2-yl)-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 299 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 7:41:24 AM |
| InChI | InChI=1S/C19H26N4O/c1-13-3-4-17-18(11-13)21-19(20-17)15-5-8-23(12-15)16-6-9-22(10-7-16)14(2)24/h3-4,11,15-16H,5-10,12H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChI Key | KDEVRUQIMRSOMR-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C4CCN(CC4)C(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT31-457184 |