Systematic / IUPAC Name: 1-[4-[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10493
Other Names: NAT31-456712
Formula: C18H22ClN3O2
1-{4-[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 602 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 7:42:59 AM |
| InChI | InChI=1S/C18H22ClN3O2/c1-12(23)21-8-5-15(6-9-21)22-7-4-13(11-22)18-20-16-10-14(19)2-3-17(16)24-18/h2-3,10,13,15H,4-9,11H2,1H3/t13-/m0/s1 |
| InChI Key | PMSHUKMNCNQAEL-ZDUSSCGKSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCC(C2)C3=NC4=C(O3)C=CC(=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT31-456712 |