Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]oxolan-2-yl]methyl]methanesulfonamide
ID: Reference10508
Other Names: NAT19-353999
Formula: C14H26N2O6S
N-({(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-(4-methyl-1-piperidinyl)-2-oxoethyl]tetrahydro-2-furanyl}methyl)methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1845 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 8:30:21 AM |
| InChI | InChI=1S/C14H26N2O6S/c1-9-3-5-16(6-4-9)12(17)7-10-13(18)14(19)11(22-10)8-15-23(2,20)21/h9-11,13-15,18-19H,3-8H2,1-2H3/t10-,11+,13-,14+/m0/s1 |
| InChI Key | QLRGIRZQLJMESU-UZGDPCLZSA-N |
| Canonical SMILES | CC1CCN(CC1)C(=O)CC2C(C(C(O2)CNS(=O)(=O)C)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353999 |