Systematic / IUPAC Name: 2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-prop-2-ynylacetamide
ID: Reference10509
Other Names: NAT19-354057
Formula: C14H23N3O5
2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-{[(isopropylcarbamoyl)amino]methyl}tetrahydro-2-furanyl]-N-(2-propyn-1-yl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1040 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 8:43:44 AM |
| InChI | InChI=1S/C14H23N3O5/c1-4-5-15-11(18)6-9-12(19)13(20)10(22-9)7-16-14(21)17-8(2)3/h1,8-10,12-13,19-20H,5-7H2,2-3H3,(H,15,18)(H2,16,17,21)/t9-,10+,12-,13+/m0/s1 |
| InChI Key | QUPFAVJVCWBXBS-JULQROHOSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(C(O1)CC(=O)NCC#C)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-354057 |