Systematic / IUPAC Name: O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate
ID: Reference1051
Other Names:
Chloropyriphos-methyl;
Trichlormethylfos;
Methyl chlorpyriphos;
Dursban methyl;
Methyl dursban
; more
Formula: C7H7Cl3NO3PS
Class: Pesticides/Herbicides
Chlorpyrifos-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3461 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/11/2014 1:20:20 PM |
| InChI | InChI=1S/C7H7Cl3NO3PS/c1-12-15(16,13-2)14-7-5(9)3-4(8)6(10)11-7/h3H,1-2H3 |
| InChI Key | HRBKVYFZANMGRE-UHFFFAOYSA-N |
| Canonical SMILES | COP(=S)(OC)OC1=NC(=C(C=C1Cl)Cl)Cl |
| CAS | 5598130 |
| Splash | |
| Other Names |
Chloropyriphos-methyl; Trichlormethylfos; Methyl chlorpyriphos; Dursban methyl; Methyl dursban; Methylchlorpyrifos; Phosphorothioic acid, O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester; Chlorpyrifos methyl; Phosphorothioic acid, O,O-dimethyl O-(3,5,6-trichloro-2-pyridyl) ester; O,O-Dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate; O,O-Dimethyl O-(3,5,6-trichloropyridin-2-yl) thiophosphate; O,O-Dimethyl O-(3,5,6-trichloropyridin-2-yl) phosphorothioate; Reldan; Noltran; Zertell; Tumar; Reldan 50 EC |
| ChEBI | CHEBI:34632 |
| KEGG | C14520 |
| PubChem | 21803 |
| ChemIDPlus | 005598130 |
| ChEMBL | CHEMBL1370646 |
| ChemSpider | 20493 |