Systematic / IUPAC Name: 6-Methyl-2-[(3S)-1-(2-methylpropyl)pyrrolidin-3-yl]-1H-benzimidazole
ID: Reference10510
Other Names: NAT31-457155
Formula: C16H23N3
2-[(3S)-1-Isobutyl-3-pyrrolidinyl]-5-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 523 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/4/2021 10:56:19 AM |
| InChI | InChI=1S/C16H23N3/c1-11(2)9-19-7-6-13(10-19)16-17-14-5-4-12(3)8-15(14)18-16/h4-5,8,11,13H,6-7,9-10H2,1-3H3,(H,17,18)/t13-/m0/s1 |
| InChI Key | YEEBUUVXUCYPQM-ZDUSSCGKSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT31-457155 |