Systematic / IUPAC Name: 2-[(3S)-1-[(4-Chlorophenyl)methyl]pyrrolidin-3-yl]-6-methyl-1H-benzimidazole
ID: Reference10511
Other Names: NAT31-457139
Formula: C19H20ClN3
2-[(3S)-1-(4-Chlorobenzyl)-3-pyrrolidinyl]-5-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 659 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/4/2021 10:58:00 AM |
| InChI | InChI=1S/C19H20ClN3/c1-13-2-7-17-18(10-13)22-19(21-17)15-8-9-23(12-15)11-14-3-5-16(20)6-4-14/h2-7,10,15H,8-9,11-12H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChI Key | NYOTXGSFKOVFGP-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT31-457139 |