Systematic / IUPAC Name: (3S,3aR,6S,6aR)-3-N-(Cyclohexylmethyl)-6-N-(4-thiophen-2-ylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine
ID: Reference10517
Other Names: NAT6-319594
Formula: C21H28N4O2S
1,4:3,6-Dianhydro-2-[(cyclohexylmethyl)amino]-2,5-dideoxy-5-{[4-(2-thienyl)-2-pyrimidinyl]amino}-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1938 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/4/2021 11:29:14 AM |
| InChI | InChI=1S/C21H28N4O2S/c1-2-5-14(6-3-1)11-23-16-12-26-20-17(13-27-19(16)20)25-21-22-9-8-15(24-21)18-7-4-10-28-18/h4,7-10,14,16-17,19-20,23H,1-3,5-6,11-13H2,(H,22,24,25)/t16-,17-,19+,20+/m0/s1 |
| InChI Key | BTRBQBJILDTZOX-RAUXBKROSA-N |
| Canonical SMILES | C1CCC(CC1)CNC2COC3C2OCC3NC4=NC=CC(=N4)C5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names | NAT6-319594 |