Systematic / IUPAC Name: 1-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-[(3R,4S)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]ethanone
ID: Reference10526
Other Names: NAT14-350133
Formula: C28H33N3O4
1-(6,7-Dimethoxy-3,4-dihydro-2(1H)-isoquinolinyl)-2-{(3R,4S)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-4-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1560 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/4/2021 9:45:02 AM |
| InChI | InChI=1S/C28H33N3O4/c1-33-26-13-21-9-11-31(18-23(21)14-27(26)34-2)28(32)15-20-8-10-29-17-22(20)12-24-16-25(35-30-24)19-6-4-3-5-7-19/h3-7,13-14,16,20,22,29H,8-12,15,17-18H2,1-2H3/t20-,22-/m0/s1 |
| InChI Key | GELOVTZWEYKQDU-UNMCSNQZSA-N |
| Canonical SMILES | COC1=C(C=C2CN(CCC2=C1)C(=O)CC3CCNCC3CC4=NOC(=C4)C5=CC=CC=C5)OC |
| CAS | |
| Splash | |
| Other Names | NAT14-350133 |