Systematic / IUPAC Name: 2-[(3S)-1-Cyclohexylpyrrolidin-3-yl]-6-methyl-1H-benzimidazole
ID: Reference10529
Other Names: NAT31-457144
Formula: C18H25N3
2-[(3S)-1-Cyclohexyl-3-pyrrolidinyl]-5-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 872 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/7/2021 9:55:58 AM |
| InChI | InChI=1S/C18H25N3/c1-13-7-8-16-17(11-13)20-18(19-16)14-9-10-21(12-14)15-5-3-2-4-6-15/h7-8,11,14-15H,2-6,9-10,12H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChI Key | ISYMAFVDMFWSTA-AWEZNQCLSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-457144 |