Systematic / IUPAC Name: 2-[(3S)-1-(Pyridin-2-ylmethyl)pyrrolidin-3-yl]-1H-benzimidazole-4-carboxamide
ID: Reference10543
Other Names: NAT31-470186
Formula: C18H19N5O
2-[(3S)-1-(2-Pyridinylmethyl)-3-pyrrolidinyl]-1H-benzimidazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3064 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/11/2021 12:05:36 PM |
| InChI | InChI=1S/C18H19N5O/c19-17(24)14-5-3-6-15-16(14)22-18(21-15)12-7-9-23(10-12)11-13-4-1-2-8-20-13/h1-6,8,12H,7,9-11H2,(H2,19,24)(H,21,22)/t12-/m0/s1 |
| InChI Key | LPDBCIAMCBETDL-LBPRGKRZSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(C=CC=C3N2)C(=O)N)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT31-470186 |
| ChEMBL | CHEMBL3437375 |
| ChemSpider | 29850799 |
| PubChem | 51137871 |