Systematic / IUPAC Name: 1-[[(1S,4S,6S)-3-Methyl-6-propan-2-yl-4-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methyl]cyclohex-2-en-1-yl]methyl]piperidine-4-carboxamide
ID: Reference10549
Other Names: NAT28-411292
Formula: C25H35N5O2
1-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]methyl}-4-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1890 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/11/2021 10:46:01 AM |
| InChI | InChI=1S/C25H35N5O2/c1-16(2)22-13-20(14-23-28-29-25(32-23)19-4-8-27-9-5-19)17(3)12-21(22)15-30-10-6-18(7-11-30)24(26)31/h4-5,8-9,12,16,18,20-22H,6-7,10-11,13-15H2,1-3H3,(H2,26,31)/t20-,21-,22-/m0/s1 |
| InChI Key | YXBRLQISXRFFAJ-FKBYEOEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=NC=C3)C(C)C)CN4CCC(CC4)C(=O)N |
| CAS | |
| Splash | |
| Other Names | NAT28-411292 |