Systematic / IUPAC Name: 2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-[(pyridin-2-ylmethylamino)methyl]oxolan-2-yl]-N-propan-2-ylacetamide
ID: Reference10560
Other Names: NAT19-353555
Formula: C16H25N3O4
2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-{[(2-pyridinylmethyl)amino]methyl}tetrahydro-2-furanyl]-N-isopropylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2796 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/18/2021 7:58:17 AM |
| InChI | InChI=1S/C16H25N3O4/c1-10(2)19-14(20)7-12-15(21)16(22)13(23-12)9-17-8-11-5-3-4-6-18-11/h3-6,10,12-13,15-17,21-22H,7-9H2,1-2H3,(H,19,20)/t12-,13+,15-,16+/m0/s1 |
| InChI Key | IZGLJFGRSOUIAV-LQKXBSAESA-N |
| Canonical SMILES | CC(C)NC(=O)CC1C(C(C(O1)CNCC2=CC=CC=N2)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353555 |