Systematic / IUPAC Name: 4-(Dimethylamino)-N-[[(2R,4S,5R)-5-(2-methyl-5-thiophen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzamide
ID: Reference10565
Other Names: NAT13-333155
Formula: C25H31N5OS
4-(Dimethylamino)-N-({(2R,4S,5R)-5-[1-methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 603 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/18/2021 8:40:34 AM |
| InChI | InChI=1S/C25H31N5OS/c1-28(2)19-8-6-17(7-9-19)25(31)26-15-20-13-18-10-11-30(20)16-21(18)23-14-22(27-29(23)3)24-5-4-12-32-24/h4-9,12,14,18,20-21H,10-11,13,15-16H2,1-3H3,(H,26,31)/t18-,20+,21-/m0/s1 |
| InChI Key | ASIGHVLQRSMXML-TYPHKJRUSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CS2)C3CN4CCC3CC4CNC(=O)C5=CC=C(C=C5)N(C)C |
| CAS | |
| Splash | |
| Other Names | NAT13-333155 |