Systematic / IUPAC Name: 5-[5-[(2S)-1-[(4-Chlorophenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridin-2-amine
ID: Reference10567
Other Names: NAT18-473548
Formula: C20H22ClN5O
5-{5-[(2S)-1-(4-Chlorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N,N-dimethyl-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 862 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/18/2021 8:49:13 AM |
| InChI | InChI=1S/C20H22ClN5O/c1-25(2)18-10-7-15(12-22-18)19-23-20(27-24-19)17-4-3-11-26(17)13-14-5-8-16(21)9-6-14/h5-10,12,17H,3-4,11,13H2,1-2H3/t17-/m0/s1 |
| InChI Key | PKGJWXMSRBZKSM-KRWDZBQOSA-N |
| Canonical SMILES | CN(C)C1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT18-473548 |