Systematic / IUPAC Name: 2-[[(2S)-2-[3-[6-(2-Methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenol
ID: Reference10579
Other Names: NAT18-432658
Formula: C21H24N4O4
2-{[(2S)-2-{3-[6-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1677 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/24/2021 11:15:13 AM |
| InChI | InChI=1S/C21H24N4O4/c1-27-11-12-28-19-9-8-15(13-22-19)20-23-21(29-24-20)17-6-4-10-25(17)14-16-5-2-3-7-18(16)26/h2-3,5,7-9,13,17,26H,4,6,10-12,14H2,1H3/t17-/m0/s1 |
| InChI Key | JURYGUBYJURYAK-KRWDZBQOSA-N |
| Canonical SMILES | COCCOC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4O |
| CAS | |
| Splash | |
| Other Names | NAT18-432658 |