Systematic / IUPAC Name: 5-[(2S)-1-(1H-Indol-3-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazole
ID: Reference10581
Other Names: NAT18-430250
Formula: C23H25N5O3
3-{[(2S)-2-{3-[2-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2803 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/24/2021 11:21:28 AM |
| InChI | InChI=1S/C23H25N5O3/c1-29-12-13-30-22-18(7-4-10-24-22)21-26-23(31-27-21)20-9-5-11-28(20)15-16-14-25-19-8-3-2-6-17(16)19/h2-4,6-8,10,14,20,25H,5,9,11-13,15H2,1H3/t20-/m0/s1 |
| InChI Key | SVMGDQPYMVDZQV-FQEVSTJZSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CNC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | NAT18-430250 |