Systematic / IUPAC Name: 1-[[(1S,4S,6S)-4-[[5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]piperidin-4-ol
ID: Reference10590
Other Names: NAT28-412254
Formula: C26H37N3O3
1-{[(1S,4S,6S)-6-Isopropyl-4-{[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methyl-2-cyclohexen-1-yl]methyl}-4-piperidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1125 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/24/2021 12:04:59 PM |
| InChI | InChI=1S/C26H37N3O3/c1-17(2)24-14-20(18(3)13-21(24)16-29-11-9-22(30)10-12-29)15-25-27-28-26(32-25)19-5-7-23(31-4)8-6-19/h5-8,13,17,20-22,24,30H,9-12,14-16H2,1-4H3/t20-,21-,24-/m0/s1 |
| InChI Key | LAHUNLSQGHLDDJ-HFMPRLQTSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)OC)C(C)C)CN4CCC(CC4)O |
| CAS | |
| Splash | |
| Other Names | NAT28-412254 |