Systematic / IUPAC Name: 5-[5-[(2S)-1-(1,3-Benzodioxol-5-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridin-2-amine
ID: Reference10597
Other Names: NAT18-473570
Formula: C21H23N5O3
5-{5-[(2S)-1-(1,3-Benzodioxol-5-ylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N,N-dimethyl-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 750 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/28/2021 9:36:04 AM |
| InChI | InChI=1S/C21H23N5O3/c1-25(2)19-8-6-15(11-22-19)20-23-21(29-24-20)16-4-3-9-26(16)12-14-5-7-17-18(10-14)28-13-27-17/h5-8,10-11,16H,3-4,9,12-13H2,1-2H3/t16-/m0/s1 |
| InChI Key | WWIVMKRLSCYJCT-INIZCTEOSA-N |
| Canonical SMILES | CN(C)C1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC5=C(C=C4)OCO5 |
| CAS | |
| Splash | |
| Other Names | NAT18-473570 |