Systematic / IUPAC Name: 5-[5-[(2S)-1-[(4-Chlorophenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N-(2-methoxyethyl)pyridin-2-amine
ID: Reference10601
Other Names: NAT18-432231
Formula: C21H24ClN5O2
5-{5-[(2S)-1-(4-Chlorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N-(2-methoxyethyl)-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1343 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/28/2021 11:30:26 AM |
| InChI | InChI=1S/C21H24ClN5O2/c1-28-12-10-23-19-9-6-16(13-24-19)20-25-21(29-26-20)18-3-2-11-27(18)14-15-4-7-17(22)8-5-15/h4-9,13,18H,2-3,10-12,14H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChI Key | SDPSXAUOGAPGED-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT18-432231 |