Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-3-yl]-5-[(2S)-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10606
Other Names: NAT18-430255
Formula: C20H29N5O3
2-(2-Methoxyethoxy)-3-{5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 865 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/29/2021 5:07:57 PM |
| InChI | InChI=1S/C20H29N5O3/c1-24-11-7-15(8-12-24)25-10-4-6-17(25)20-22-18(23-28-20)16-5-3-9-21-19(16)27-14-13-26-2/h3,5,9,15,17H,4,6-8,10-14H2,1-2H3/t17-/m0/s1 |
| InChI Key | MWWFMMBRJATCDZ-KRWDZBQOSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=C(N=CC=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-430255 |