Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-4-yl]-5-[(2S)-1-[(4-methylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10612
Other Names: NAT18-429071
Formula: C22H26N4O3
2-(2-Methoxyethoxy)-4-{5-[(2S)-1-(4-methylbenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/2/2021 6:34:02 AM |
| InChI | InChI=1S/C22H26N4O3/c1-16-5-7-17(8-6-16)15-26-11-3-4-19(26)22-24-21(25-29-22)18-9-10-23-20(14-18)28-13-12-27-2/h5-10,14,19H,3-4,11-13,15H2,1-2H3/t19-/m0/s1 |
| InChI Key | PPUGKUPAQNVMIP-IBGZPJMESA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=CC(=NC=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-429071 |